C16H21N3O5 — CID 11883285
2-[[(3S,3aR,6R,6aS)-3-(benzylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide (PubChem CID 11883285) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[[(3S,3aR,6R,6aS)-3-(benzylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide.
| Compound Name | 2-[[(3S,3aR,6R,6aS)-3-(benzylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 11883285 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-[[(3S,3aR,6R,6aS)-3-(benzylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide |
| SMILES | NC(=O)CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H21N3O5/c17-13(20)9-22-12-8-24-14-11(7-23-15(12)14)19-16(21)18-6-10-4-2-1-3-5-10/h1-5,11-12,14-15H,6-9H2,(H2,17,20)(H2,18,19,21)/t11-,12+,14+,15+/m0/s1 |
| InChIKey | KHVZBNJQPKPPDX-CTHBEMJXSA-N |
| XLogP | -0.48 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |