C7H2Br2F2N2 — CID 118833890
2,3-dibromo-5-(difluoromethyl)pyridine-4-carbonitrile (PubChem CID 118833890) has the molecular formula C7H2Br2F2N2 and a molecular weight of 311.91 g/mol. Its IUPAC name is 2,3-dibromo-5-(difluoromethyl)pyridine-4-carbonitrile.
| Compound Name | 2,3-dibromo-5-(difluoromethyl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 118833890 |
| Molecular Formula | C7H2Br2F2N2 |
| Molecular Weight | 311.91 g/mol |
| Exact Mass | 309.86 |
| IUPAC Name | 2,3-dibromo-5-(difluoromethyl)pyridine-4-carbonitrile |
| SMILES | N#Cc1c(C(F)F)cnc(Br)c1Br |
| InChI | InChI=1S/C7H2Br2F2N2/c8-5-3(1-12)4(7(10)11)2-13-6(5)9/h2,7H |
| InChIKey | WSSKSZWRADUVJN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.91 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|