C8H8F2N2O3 — CID 118834252
4-(difluoromethyl)-2-methoxy-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 118834252) has the molecular formula C8H8F2N2O3 and a molecular weight of 218.16 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-methoxy-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 4-(difluoromethyl)-2-methoxy-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118834252 |
| Molecular Formula | C8H8F2N2O3 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 4-(difluoromethyl)-2-methoxy-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | COc1[nH]c(=O)cc(C(F)F)c1C(N)=O |
| InChI | InChI=1S/C8H8F2N2O3/c1-15-8-5(7(11)14)3(6(9)10)2-4(13)12-8/h2,6H,1H3,(H2,11,14)(H,12,13) |
| InChIKey | LJWVSJPRMCLKJN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |