C7H4F3N3O2 — CID 118834504
4-amino-3-hydroxy-5-(trifluoromethoxy)pyridine-2-carbonitrile (PubChem CID 118834504) has the molecular formula C7H4F3N3O2 and a molecular weight of 219.12 g/mol. Its IUPAC name is 4-amino-3-hydroxy-5-(trifluoromethoxy)pyridine-2-carbonitrile.
| Compound Name | 4-amino-3-hydroxy-5-(trifluoromethoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 118834504 |
| Molecular Formula | C7H4F3N3O2 |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 4-amino-3-hydroxy-5-(trifluoromethoxy)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(OC(F)(F)F)c(N)c1O |
| InChI | InChI=1S/C7H4F3N3O2/c8-7(9,10)15-4-2-13-3(1-11)6(14)5(4)12/h2,14H,(H2,12,13) |
| InChIKey | ZHERMJRXPAWOLG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |