C8H9F2NO3 — CID 118835243
4-(difluoromethyl)-2-(hydroxymethyl)-5-methoxypyridin-3-ol (PubChem CID 118835243) has the molecular formula C8H9F2NO3 and a molecular weight of 205.16 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-(hydroxymethyl)-5-methoxypyridin-3-ol.
| Compound Name | 4-(difluoromethyl)-2-(hydroxymethyl)-5-methoxypyridin-3-ol |
|---|---|
| PubChem CID | 118835243 |
| Molecular Formula | C8H9F2NO3 |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-(difluoromethyl)-2-(hydroxymethyl)-5-methoxypyridin-3-ol |
| SMILES | COc1cnc(CO)c(O)c1C(F)F |
| InChI | InChI=1S/C8H9F2NO3/c1-14-5-2-11-4(3-12)7(13)6(5)8(9)10/h2,8,12-13H,3H2,1H3 |
| InChIKey | RTXBLBYMOWZMDM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |