C10H8F5N3O — CID 118836861
2-[6-(aminomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)-2-pyridinyl]acetonitrile (PubChem CID 118836861) has the molecular formula C10H8F5N3O and a molecular weight of 281.18 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[6-(aminomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118836861 |
| Molecular Formula | C10H8F5N3O |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-[6-(aminomethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1nc(CN)c(C(F)F)cc1OC(F)(F)F |
| InChI | InChI=1S/C10H8F5N3O/c11-9(12)5-3-8(19-10(13,14)15)6(1-2-16)18-7(5)4-17/h3,9H,1,4,17H2 |
| InChIKey | SXXCVJXRZPWVTF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |