C9H7BrF2O — CID 118838056
2-bromo-1-(2,3-difluoro-5-methylphenyl)ethanone (PubChem CID 118838056) has the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. Its IUPAC name is 2-bromo-1-(2,3-difluoro-5-methylphenyl)ethanone.
| Compound Name | 2-bromo-1-(2,3-difluoro-5-methylphenyl)ethanone |
|---|---|
| PubChem CID | 118838056 |
| Molecular Formula | C9H7BrF2O |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 2-bromo-1-(2,3-difluoro-5-methylphenyl)ethanone |
| SMILES | Cc1cc(F)c(F)c(C(=O)CBr)c1 |
| InChI | InChI=1S/C9H7BrF2O/c1-5-2-6(8(13)4-10)9(12)7(11)3-5/h2-3H,4H2,1H3 |
| InChIKey | XIEGXQXWIGBGAJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|