C11H9F2NO3 — CID 118838891
2-[4-cyano-2-(difluoromethyl)-6-methoxyphenyl]acetic acid (PubChem CID 118838891) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is 2-[4-cyano-2-(difluoromethyl)-6-methoxyphenyl]acetic acid.
| Compound Name | 2-[4-cyano-2-(difluoromethyl)-6-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 118838891 |
| Molecular Formula | C11H9F2NO3 |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-[4-cyano-2-(difluoromethyl)-6-methoxyphenyl]acetic acid |
| SMILES | COc1cc(C#N)cc(C(F)F)c1CC(=O)O |
| InChI | InChI=1S/C11H9F2NO3/c1-17-9-3-6(5-14)2-8(11(12)13)7(9)4-10(15)16/h2-3,11H,4H2,1H3,(H,15,16) |
| InChIKey | WSVUFCXSIJLXKA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |