C24H20ClN3O4S — CID 11884211
(4aR)-9-(5-chloro-2-methoxyphenyl)-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 11884211) has the molecular formula C24H20ClN3O4S and a molecular weight of 481.96 g/mol. Its IUPAC name is (4aR)-9-(5-chloro-2-methoxyphenyl)-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | (4aR)-9-(5-chloro-2-methoxyphenyl)-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 11884211 |
| Molecular Formula | C24H20ClN3O4S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | (4aR)-9-(5-chloro-2-methoxyphenyl)-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c(c1)C(=O)N1CCN(C(=O)c3cccs3)C[C@@H]1C(=O)N2 |
| InChI | InChI=1S/C24H20ClN3O4S/c1-32-20-7-5-15(25)12-16(20)14-4-6-18-17(11-14)23(30)28-9-8-27(13-19(28)22(29)26-18)24(31)21-3-2-10-33-21/h2-7,10-12,19H,8-9,13H2,1H3,(H,26,29)/t19-/m1/s1 |
| InChIKey | RMEHVVTWFVAVSN-LJQANCHMSA-N |
| XLogP | 4.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |