C25H27FN4O3 — CID 11884271
(4aR)-N-cyclohexyl-9-(2-fluorophenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide (PubChem CID 11884271) has the molecular formula C25H27FN4O3 and a molecular weight of 450.51 g/mol. Its IUPAC name is (4aR)-N-cyclohexyl-9-(2-fluorophenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide.
| Compound Name | (4aR)-N-cyclohexyl-9-(2-fluorophenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 11884271 |
| Molecular Formula | C25H27FN4O3 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (4aR)-N-cyclohexyl-9-(2-fluorophenyl)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-3-carboxamide |
| SMILES | O=C1Nc2ccc(-c3ccccc3F)cc2C(=O)N2CCN(C(=O)NC3CCCCC3)C[C@H]12 |
| InChI | InChI=1S/C25H27FN4O3/c26-20-9-5-4-8-18(20)16-10-11-21-19(14-16)24(32)30-13-12-29(15-22(30)23(31)28-21)25(33)27-17-6-2-1-3-7-17/h4-5,8-11,14,17,22H,1-3,6-7,12-13,15H2,(H,27,33)(H,28,31)/t22-/m1/s1 |
| InChIKey | FWDXVEYHDFFSIF-JOCHJYFZSA-N |
| XLogP | 3.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |