C6H2F2I2N2O2 — CID 118842792
2-(difluoromethyl)-3,4-diiodo-6-nitropyridine (PubChem CID 118842792) has the molecular formula C6H2F2I2N2O2 and a molecular weight of 425.90 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,4-diiodo-6-nitropyridine.
| Compound Name | 2-(difluoromethyl)-3,4-diiodo-6-nitropyridine |
|---|---|
| PubChem CID | 118842792 |
| Molecular Formula | C6H2F2I2N2O2 |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.82 |
| IUPAC Name | 2-(difluoromethyl)-3,4-diiodo-6-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(I)c(I)c(C(F)F)n1 |
| InChI | InChI=1S/C6H2F2I2N2O2/c7-6(8)5-4(10)2(9)1-3(11-5)12(13)14/h1,6H |
| InChIKey | ZXGQGBQUAIPPAZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|