C23H18FN3O4 — CID 11884281
(4aS)-9-(2-fluorophenyl)-3-(furan-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 11884281) has the molecular formula C23H18FN3O4 and a molecular weight of 419.41 g/mol. Its IUPAC name is (4aS)-9-(2-fluorophenyl)-3-(furan-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | (4aS)-9-(2-fluorophenyl)-3-(furan-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 11884281 |
| Molecular Formula | C23H18FN3O4 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (4aS)-9-(2-fluorophenyl)-3-(furan-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | O=C1Nc2ccc(-c3ccccc3F)cc2C(=O)N2CCN(C(=O)c3ccco3)C[C@@H]12 |
| InChI | InChI=1S/C23H18FN3O4/c24-17-5-2-1-4-15(17)14-7-8-18-16(12-14)22(29)27-10-9-26(13-19(27)21(28)25-18)23(30)20-6-3-11-31-20/h1-8,11-12,19H,9-10,13H2,(H,25,28)/t19-/m0/s1 |
| InChIKey | URLOXPPLZZFSPY-IBGZPJMESA-N |
| XLogP | 3.00 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |