C8H5F2IN2O — CID 118842993
2-[6-(difluoromethyl)-5-iodo-4-oxo-1H-pyridin-3-yl]acetonitrile (PubChem CID 118842993) has the molecular formula C8H5F2IN2O and a molecular weight of 310.04 g/mol. Its IUPAC name is 2-[6-(difluoromethyl)-5-iodo-4-oxo-1H-pyridin-3-yl]acetonitrile.
| Compound Name | 2-[6-(difluoromethyl)-5-iodo-4-oxo-1H-pyridin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 118842993 |
| Molecular Formula | C8H5F2IN2O |
| Molecular Weight | 310.04 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | 2-[6-(difluoromethyl)-5-iodo-4-oxo-1H-pyridin-3-yl]acetonitrile |
| SMILES | N#CCc1c[nH]c(C(F)F)c(I)c1=O |
| InChI | InChI=1S/C8H5F2IN2O/c9-8(10)6-5(11)7(14)4(1-2-12)3-13-6/h3,8H,1H2,(H,13,14) |
| InChIKey | FABDEHQXORHMOW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.04 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|