C22H22ClN3O4S — CID 11884319
(4aR)-9-(5-chloro-2-methoxyphenyl)-3-(2-methylsulfanylacetyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 11884319) has the molecular formula C22H22ClN3O4S and a molecular weight of 459.96 g/mol. Its IUPAC name is (4aR)-9-(5-chloro-2-methoxyphenyl)-3-(2-methylsulfanylacetyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | (4aR)-9-(5-chloro-2-methoxyphenyl)-3-(2-methylsulfanylacetyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 11884319 |
| Molecular Formula | C22H22ClN3O4S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | (4aR)-9-(5-chloro-2-methoxyphenyl)-3-(2-methylsulfanylacetyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | COc1ccc(Cl)cc1-c1ccc2c(c1)C(=O)N1CCN(C(=O)CSC)C[C@@H]1C(=O)N2 |
| InChI | InChI=1S/C22H22ClN3O4S/c1-30-19-6-4-14(23)10-15(19)13-3-5-17-16(9-13)22(29)26-8-7-25(20(27)12-31-2)11-18(26)21(28)24-17/h3-6,9-10,18H,7-8,11-12H2,1-2H3,(H,24,28)/t18-/m1/s1 |
| InChIKey | MKQYLHYLVVHKRW-GOSISDBHSA-N |
| XLogP | 2.98 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |