C12H21NO4 — CID 11884348
N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-ethylbutanamide (PubChem CID 11884348) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-ethylbutanamide.
| Compound Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 11884348 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C12H21NO4/c1-3-7(4-2)12(15)13-8-5-16-11-9(14)6-17-10(8)11/h7-11,14H,3-6H2,1-2H3,(H,13,15)/t8-,9+,10+,11+/m0/s1 |
| InChIKey | TUUNWVKUIKOYFY-LNFKQOIKSA-N |
| XLogP | 0.07 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |