C9H7BrF5NO — CID 118843944
2-(bromomethyl)-6-(difluoromethyl)-4-methoxy-3-(trifluoromethyl)pyridine (PubChem CID 118843944) has the molecular formula C9H7BrF5NO and a molecular weight of 320.06 g/mol. Its IUPAC name is 2-(bromomethyl)-6-(difluoromethyl)-4-methoxy-3-(trifluoromethyl)pyridine.
| Compound Name | 2-(bromomethyl)-6-(difluoromethyl)-4-methoxy-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 118843944 |
| Molecular Formula | C9H7BrF5NO |
| Molecular Weight | 320.06 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 2-(bromomethyl)-6-(difluoromethyl)-4-methoxy-3-(trifluoromethyl)pyridine |
| SMILES | COc1cc(C(F)F)nc(CBr)c1C(F)(F)F |
| InChI | InChI=1S/C9H7BrF5NO/c1-17-6-2-4(8(11)12)16-5(3-10)7(6)9(13,14)15/h2,8H,3H2,1H3 |
| InChIKey | ROGCTWYBACZVNY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|