About 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one
2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one (PubChem CID 118844674) has the molecular formula C12H5Cl3F3NO
and a molecular weight of 342.53 g/mol. Its IUPAC name is 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one |
| PubChem CID | 118844674 |
| Molecular Formula | C12H5Cl3F3NO |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]c(-c2c(Cl)cc(Cl)cc2Cl)c1C(F)(F)F |
| InChI | InChI=1S/C12H5Cl3F3NO/c13-5-3-6(14)9(7(15)4-5)11-10(12(16,17)18)8(20)1-2-19-11/h1-4H,(H,19,20) |
| InChIKey | KKOVYALRPWWXKB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one?
The IUPAC name of 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one (CID 118844674) is 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one.
What is the SMILES notation for 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one?
The canonical SMILES for 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one is O=c1cc[nH]c(-c2c(Cl)cc(Cl)cc2Cl)c1C(F)(F)F.
What is the InChIKey of 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one?
The InChIKey is KKOVYALRPWWXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl3F3NO/c13-5-3-6(14)9(7(15)4-5)11-10(12(16,17)18)8(20)1-2-19-11/h1-4H,(H,19,20).
What are the key properties of 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one?
2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one has a molecular weight of 342.53 g/mol, XLogP of 5.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,6-trichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one is sourced from PubChem (CID 118844674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).