C7H2ClI2NO2S — CID 118844807
4-cyano-3,5-diiodobenzenesulfonyl chloride (PubChem CID 118844807) has the molecular formula C7H2ClI2NO2S and a molecular weight of 453.43 g/mol. Its IUPAC name is 4-cyano-3,5-diiodobenzenesulfonyl chloride.
| Compound Name | 4-cyano-3,5-diiodobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 118844807 |
| Molecular Formula | C7H2ClI2NO2S |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 452.76 |
| IUPAC Name | 4-cyano-3,5-diiodobenzenesulfonyl chloride |
| SMILES | N#Cc1c(I)cc(S(=O)(=O)Cl)cc1I |
| InChI | InChI=1S/C7H2ClI2NO2S/c8-14(12,13)4-1-6(9)5(3-11)7(10)2-4/h1-2H |
| InChIKey | ZPSMVTJRJFXMFK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|