C17H23N3O2S — CID 11884488
(4aS,7aR)-3-cyclohexyl-1-(thiophen-2-ylmethyl)-5,6,7,7a-tetrahydro-4aH-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 11884488) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is (4aS,7aR)-3-cyclohexyl-1-(thiophen-2-ylmethyl)-5,6,7,7a-tetrahydro-4aH-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | (4aS,7aR)-3-cyclohexyl-1-(thiophen-2-ylmethyl)-5,6,7,7a-tetrahydro-4aH-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11884488 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (4aS,7aR)-3-cyclohexyl-1-(thiophen-2-ylmethyl)-5,6,7,7a-tetrahydro-4aH-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C1[C@H]2NCC[C@H]2N(Cc2cccs2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C17H23N3O2S/c21-16-15-14(8-9-18-15)19(11-13-7-4-10-23-13)17(22)20(16)12-5-2-1-3-6-12/h4,7,10,12,14-15,18H,1-3,5-6,8-9,11H2/t14-,15+/m1/s1 |
| InChIKey | BXMRXDUFKJYBNH-CABCVRRESA-N |
| XLogP | 2.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |