C21H23FN4O3S — CID 11884504
(4aS,7aR)-3-(3-fluorophenyl)-2,4-dioxo-N-propyl-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidine-5-carboxamide (PubChem CID 11884504) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is (4aS,7aR)-3-(3-fluorophenyl)-2,4-dioxo-N-propyl-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidine-5-carboxamide.
| Compound Name | (4aS,7aR)-3-(3-fluorophenyl)-2,4-dioxo-N-propyl-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11884504 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (4aS,7aR)-3-(3-fluorophenyl)-2,4-dioxo-N-propyl-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidine-5-carboxamide |
| SMILES | CCCNC(=O)N1CC[C@@H]2[C@H]1C(=O)N(c1cccc(F)c1)C(=O)N2Cc1cccs1 |
| InChI | InChI=1S/C21H23FN4O3S/c1-2-9-23-20(28)24-10-8-17-18(24)19(27)26(15-6-3-5-14(22)12-15)21(29)25(17)13-16-7-4-11-30-16/h3-7,11-12,17-18H,2,8-10,13H2,1H3,(H,23,28)/t17-,18+/m1/s1 |
| InChIKey | ZWATUTXZTUTUAC-MSOLQXFVSA-N |
| XLogP | 3.42 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |