C15H20N2O4 — CID 11884560
2-[[(3S,3aR,6R,6aS)-3-(benzylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide (PubChem CID 11884560) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[[(3S,3aR,6R,6aS)-3-(benzylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide.
| Compound Name | 2-[[(3S,3aR,6R,6aS)-3-(benzylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide |
|---|---|
| PubChem CID | 11884560 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[[(3S,3aR,6R,6aS)-3-(benzylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide |
| SMILES | NC(=O)CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O4/c16-13(18)9-19-12-8-21-14-11(7-20-15(12)14)17-6-10-4-2-1-3-5-10/h1-5,11-12,14-15,17H,6-9H2,(H2,16,18)/t11-,12+,14+,15+/m0/s1 |
| InChIKey | RUPBVSMPXPIUIT-CTHBEMJXSA-N |
| XLogP | -0.19 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |