C17H13Cl5N2 — CID 118845898
N,N-dimethyl-1-[4-(2,3,4,5,6-pentachlorophenyl)-1H-indol-3-yl]methanamine (PubChem CID 118845898) has the molecular formula C17H13Cl5N2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-(2,3,4,5,6-pentachlorophenyl)-1H-indol-3-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[4-(2,3,4,5,6-pentachlorophenyl)-1H-indol-3-yl]methanamine |
|---|---|
| PubChem CID | 118845898 |
| Molecular Formula | C17H13Cl5N2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 419.95 |
| IUPAC Name | N,N-dimethyl-1-[4-(2,3,4,5,6-pentachlorophenyl)-1H-indol-3-yl]methanamine |
| SMILES | CN(C)Cc1c[nH]c2cccc(-c3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)c12 |
| InChI | InChI=1S/C17H13Cl5N2/c1-24(2)7-8-6-23-10-5-3-4-9(11(8)10)12-13(18)15(20)17(22)16(21)14(12)19/h3-6,23H,7H2,1-2H3 |
| InChIKey | VXKBXVWOYVYAPB-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|