C11H6Cl2FNO — CID 118846322
4-(3,5-dichlorophenyl)-6-fluoro-1H-pyridin-2-one (PubChem CID 118846322) has the molecular formula C11H6Cl2FNO and a molecular weight of 258.08 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-6-fluoro-1H-pyridin-2-one.
| Compound Name | 4-(3,5-dichlorophenyl)-6-fluoro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118846322 |
| Molecular Formula | C11H6Cl2FNO |
| Molecular Weight | 258.08 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-6-fluoro-1H-pyridin-2-one |
| SMILES | O=c1cc(-c2cc(Cl)cc(Cl)c2)cc(F)[nH]1 |
| InChI | InChI=1S/C11H6Cl2FNO/c12-8-1-6(2-9(13)5-8)7-3-10(14)15-11(16)4-7/h1-5H,(H,15,16) |
| InChIKey | PRODUDGZWXXJBV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.08 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|