About 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one
4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one (PubChem CID 118846346) has the molecular formula C6H5F2NO3
and a molecular weight of 177.11 g/mol. Its IUPAC name is 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one |
| PubChem CID | 118846346 |
| Molecular Formula | C6H5F2NO3 |
| Molecular Weight | 177.11 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one |
| SMILES | O=c1cc(C(F)F)c(O)c(O)[nH]1 |
| InChI | InChI=1S/C6H5F2NO3/c7-5(8)2-1-3(10)9-6(12)4(2)11/h1,5,11H,(H2,9,10,12) |
| InChIKey | FMBUFGMKFIJSAW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one?
The IUPAC name of 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one (CID 118846346) is 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one.
What is the SMILES notation for 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one?
The canonical SMILES for 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one is O=c1cc(C(F)F)c(O)c(O)[nH]1.
What is the InChIKey of 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one?
The InChIKey is FMBUFGMKFIJSAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2NO3/c7-5(8)2-1-3(10)9-6(12)4(2)11/h1,5,11H,(H2,9,10,12).
What are the key properties of 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one?
4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one has a molecular weight of 177.11 g/mol, XLogP of 0.72, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-5,6-dihydroxy-1H-pyridin-2-one is sourced from PubChem (CID 118846346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).