C7H2Cl2F5N — CID 118846674
4,6-dichloro-3-(difluoromethyl)-2-(trifluoromethyl)pyridine (PubChem CID 118846674) has the molecular formula C7H2Cl2F5N and a molecular weight of 266.00 g/mol. Its IUPAC name is 4,6-dichloro-3-(difluoromethyl)-2-(trifluoromethyl)pyridine.
| Compound Name | 4,6-dichloro-3-(difluoromethyl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 118846674 |
| Molecular Formula | C7H2Cl2F5N |
| Molecular Weight | 266.00 g/mol |
| Exact Mass | 264.95 |
| IUPAC Name | 4,6-dichloro-3-(difluoromethyl)-2-(trifluoromethyl)pyridine |
| SMILES | FC(F)c1c(Cl)cc(Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C7H2Cl2F5N/c8-2-1-3(9)15-5(7(12,13)14)4(2)6(10)11/h1,6H |
| InChIKey | SBQISZLDZNPQPO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.00 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|