C9H2F9IO — CID 118847326
1-iodo-4-(trifluoromethoxy)-2,5-bis(trifluoromethyl)benzene (PubChem CID 118847326) has the molecular formula C9H2F9IO and a molecular weight of 424.00 g/mol. Its IUPAC name is 1-iodo-4-(trifluoromethoxy)-2,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-iodo-4-(trifluoromethoxy)-2,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 118847326 |
| Molecular Formula | C9H2F9IO |
| Molecular Weight | 424.00 g/mol |
| Exact Mass | 423.90 |
| IUPAC Name | 1-iodo-4-(trifluoromethoxy)-2,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)Oc1cc(C(F)(F)F)c(I)cc1C(F)(F)F |
| InChI | InChI=1S/C9H2F9IO/c10-7(11,12)3-2-6(20-9(16,17)18)4(1-5(3)19)8(13,14)15/h1-2H |
| InChIKey | RJRVFCQJWVMTTG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.00 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|