C12H6Cl2F3NO — CID 118847480
2-(2,3-dichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one (PubChem CID 118847480) has the molecular formula C12H6Cl2F3NO and a molecular weight of 308.09 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one.
| Compound Name | 2-(2,3-dichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 118847480 |
| Molecular Formula | C12H6Cl2F3NO |
| Molecular Weight | 308.09 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-3-(trifluoromethyl)-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]c(-c2cccc(Cl)c2Cl)c1C(F)(F)F |
| InChI | InChI=1S/C12H6Cl2F3NO/c13-7-3-1-2-6(10(7)14)11-9(12(15,16)17)8(19)4-5-18-11/h1-5H,(H,18,19) |
| InChIKey | XPOHXZAHTQYOPD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.09 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |