C12H5F6N — CID 118848870
2,3,5-trifluoro-6-[2-(trifluoromethyl)phenyl]pyridine (PubChem CID 118848870) has the molecular formula C12H5F6N and a molecular weight of 277.17 g/mol. Its IUPAC name is 2,3,5-trifluoro-6-[2-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 2,3,5-trifluoro-6-[2-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 118848870 |
| Molecular Formula | C12H5F6N |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2,3,5-trifluoro-6-[2-(trifluoromethyl)phenyl]pyridine |
| SMILES | Fc1cc(F)c(-c2ccccc2C(F)(F)F)nc1F |
| InChI | InChI=1S/C12H5F6N/c13-8-5-9(14)11(15)19-10(8)6-3-1-2-4-7(6)12(16,17)18/h1-5H |
| InChIKey | ISOFQIVYWRQNEB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|