C13H4Cl3F6N — CID 118850830
3-(3,4,5-trichlorophenyl)-4,5-bis(trifluoromethyl)pyridine (PubChem CID 118850830) has the molecular formula C13H4Cl3F6N and a molecular weight of 394.53 g/mol. Its IUPAC name is 3-(3,4,5-trichlorophenyl)-4,5-bis(trifluoromethyl)pyridine.
| Compound Name | 3-(3,4,5-trichlorophenyl)-4,5-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 118850830 |
| Molecular Formula | C13H4Cl3F6N |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 392.93 |
| IUPAC Name | 3-(3,4,5-trichlorophenyl)-4,5-bis(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cncc(-c2cc(Cl)c(Cl)c(Cl)c2)c1C(F)(F)F |
| InChI | InChI=1S/C13H4Cl3F6N/c14-8-1-5(2-9(15)11(8)16)6-3-23-4-7(12(17,18)19)10(6)13(20,21)22/h1-4H |
| InChIKey | OJGRARAUVPGJRI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|