C12H9Cl2NO — CID 118852441
4-(2,6-dichlorophenyl)-2-methoxypyridine (PubChem CID 118852441) has the molecular formula C12H9Cl2NO and a molecular weight of 254.12 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-2-methoxypyridine.
| Compound Name | 4-(2,6-dichlorophenyl)-2-methoxypyridine |
|---|---|
| PubChem CID | 118852441 |
| Molecular Formula | C12H9Cl2NO |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-2-methoxypyridine |
| SMILES | COc1cc(-c2c(Cl)cccc2Cl)ccn1 |
| InChI | InChI=1S/C12H9Cl2NO/c1-16-11-7-8(5-6-15-11)12-9(13)3-2-4-10(12)14/h2-7H,1H3 |
| InChIKey | KTINZQWRCRKKHR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |