C11H12O4 — CID 118852502
2-hydroxy-2-[2-(3-oxopropyl)phenyl]acetic acid (PubChem CID 118852502) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-hydroxy-2-[2-(3-oxopropyl)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[2-(3-oxopropyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 118852502 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-hydroxy-2-[2-(3-oxopropyl)phenyl]acetic acid |
| SMILES | O=CCCc1ccccc1C(O)C(=O)O |
| InChI | InChI=1S/C11H12O4/c12-7-3-5-8-4-1-2-6-9(8)10(13)11(14)15/h1-2,4,6-7,10,13H,3,5H2,(H,14,15) |
| InChIKey | QIMBGBGWRDHTDW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|