C17H21INO4- — CID 11885504
(2S,4R)-4-[(3-iodophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylate (PubChem CID 11885504) has the molecular formula C17H21INO4- and a molecular weight of 430.26 g/mol. Its IUPAC name is (2S,4R)-4-[(3-iodophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylate.
| Compound Name | (2S,4R)-4-[(3-iodophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11885504 |
| Molecular Formula | C17H21INO4- |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (2S,4R)-4-[(3-iodophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](Cc2cccc(I)c2)C[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C17H22INO4/c1-17(2,3)23-16(22)19-10-12(9-14(19)15(20)21)7-11-5-4-6-13(18)8-11/h4-6,8,12,14H,7,9-10H2,1-3H3,(H,20,21)/p-1/t12-,14+/m1/s1 |
| InChIKey | VQERMIXCSDCMKD-OCCSQVGLSA-M |
| XLogP | 2.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|