C9H8BrF2NO2 — CID 118855110
2-[2-(bromomethyl)-6-(difluoromethyl)-4-pyridinyl]acetic acid (PubChem CID 118855110) has the molecular formula C9H8BrF2NO2 and a molecular weight of 280.07 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-6-(difluoromethyl)-4-pyridinyl]acetic acid.
| Compound Name | 2-[2-(bromomethyl)-6-(difluoromethyl)-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118855110 |
| Molecular Formula | C9H8BrF2NO2 |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | 2-[2-(bromomethyl)-6-(difluoromethyl)-4-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(CBr)nc(C(F)F)c1 |
| InChI | InChI=1S/C9H8BrF2NO2/c10-4-6-1-5(3-8(14)15)2-7(13-6)9(11)12/h1-2,9H,3-4H2,(H,14,15) |
| InChIKey | IWCQCOZOIVNPOX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|