C19H34O5Si — CID 118855400
(3aR,4S,5R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-6a-methyl-5-(oxan-2-yloxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 118855400) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-6a-methyl-5-(oxan-2-yloxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-6a-methyl-5-(oxan-2-yloxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 118855400 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (3aR,4S,5R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-6a-methyl-5-(oxan-2-yloxy)-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H]2CC(=O)O[C@@]2(C)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C19H34O5Si/c1-18(2,3)25(5,6)24-17-13-11-15(20)23-19(13,4)12-14(17)22-16-9-7-8-10-21-16/h13-14,16-17H,7-12H2,1-6H3/t13-,14-,16?,17+,19+/m1/s1 |
| InChIKey | DBVHNTINBQKJPH-JSZBWZQPSA-N |
| XLogP | 4.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|