C12H12F3NO2 — CID 11885541
(3S,4R)-4-[2-(trifluoromethyl)phenyl]pyrrolidin-1-ium-3-carboxylate (PubChem CID 11885541) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is (3S,4R)-4-[2-(trifluoromethyl)phenyl]pyrrolidin-1-ium-3-carboxylate.
| Compound Name | (3S,4R)-4-[2-(trifluoromethyl)phenyl]pyrrolidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 11885541 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (3S,4R)-4-[2-(trifluoromethyl)phenyl]pyrrolidin-1-ium-3-carboxylate |
| SMILES | O=C([O-])[C@@H]1C[NH2+]C[C@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO2/c13-12(14,15)10-4-2-1-3-7(10)8-5-16-6-9(8)11(17)18/h1-4,8-9,16H,5-6H2,(H,17,18)/t8-,9+/m0/s1 |
| InChIKey | CDBDQHBPLLUGEZ-DTWKUNHWSA-N |
| XLogP | -0.27 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |