C25H26N10O6 — CID 118855551
N-[9-[(2R,4R,5S)-3-hydroxy-5-(hydroxymethyl)-4-[4-[(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)methyl]triazol-1-yl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 118855551) has the molecular formula C25H26N10O6 and a molecular weight of 562.55 g/mol. Its IUPAC name is N-[9-[(2R,4R,5S)-3-hydroxy-5-(hydroxymethyl)-4-[4-[(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)methyl]triazol-1-yl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4R,5S)-3-hydroxy-5-(hydroxymethyl)-4-[4-[(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)methyl]triazol-1-yl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 118855551 |
| Molecular Formula | C25H26N10O6 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | N-[9-[(2R,4R,5S)-3-hydroxy-5-(hydroxymethyl)-4-[4-[(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)methyl]triazol-1-yl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC1CN(Cc2cn([C@@H]3C(O)[C@H](n4cnc5c(NC(=O)c6ccccc6)ncnc54)O[C@@H]3CO)nn2)C(=O)NC1=O |
| InChI | InChI=1S/C25H26N10O6/c1-13-7-33(25(40)30-22(13)38)8-15-9-35(32-31-15)18-16(10-36)41-24(19(18)37)34-12-28-17-20(26-11-27-21(17)34)29-23(39)14-5-3-2-4-6-14/h2-6,9,11-13,16,18-19,24,36-37H,7-8,10H2,1H3,(H,30,38,40)(H,26,27,29,39)/t13?,16-,18+,19?,24-/m1/s1 |
| InChIKey | PEUZEUDZKDCEMV-UHAWWYQFSA-N |
| XLogP | -0.15 |
| TPSA | 202.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |