C21H28O3S — CID 118855559
1-(7-methylsulfonylheptyl)-4-phenylmethoxybenzene (PubChem CID 118855559) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is 1-(7-methylsulfonylheptyl)-4-phenylmethoxybenzene.
| Compound Name | 1-(7-methylsulfonylheptyl)-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 118855559 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-(7-methylsulfonylheptyl)-4-phenylmethoxybenzene |
| SMILES | CS(=O)(=O)CCCCCCCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28O3S/c1-25(22,23)17-9-4-2-3-6-10-19-13-15-21(16-14-19)24-18-20-11-7-5-8-12-20/h5,7-8,11-16H,2-4,6,9-10,17-18H2,1H3 |
| InChIKey | OSBGXGBKJNYTHH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|