About MesTpCu(CNAr)
MesTpCu(CNAr) (PubChem CID 118855575) has the molecular formula C45H48BCuN7
and a molecular weight of 761.29 g/mol.
Molecular Properties
| Compound Name | MesTpCu(CNAr) |
| PubChem CID | 118855575 |
| Molecular Formula | C45H48BCuN7 |
| Molecular Weight | 761.29 g/mol |
| Exact Mass | 760.34 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2ccn([B-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.[C-]#[N+]c1c(C)cccc1C.[Cu+] |
| InChI | InChI=1S/C36H39BN6.C9H9N.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;1-7-5-4-6-8(2)9(7)10-3;/h10-21H,1-9H3;4-6H,1-2H3;/q-1;;+1 |
| InChIKey | CYSIQVCVRMQAFB-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 57.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 761.29 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze MesTpCu(CNAr) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of MesTpCu(CNAr)?
The IUPAC name of MesTpCu(CNAr) (CID 118855575) is not available.
What is the SMILES notation for MesTpCu(CNAr)?
The canonical SMILES for MesTpCu(CNAr) is Cc1cc(C)c(-c2ccn([B-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.[C-]#[N+]c1c(C)cccc1C.[Cu+].
What is the InChIKey of MesTpCu(CNAr)?
The InChIKey is CYSIQVCVRMQAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H39BN6.C9H9N.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;1-7-5-4-6-8(2)9(7)10-3;/h10-21H,1-9H3;4-6H,1-2H3;/q-1;;+1.
What are the key properties of MesTpCu(CNAr)?
MesTpCu(CNAr) has a molecular weight of 761.29 g/mol, XLogP of 10.83, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for MesTpCu(CNAr) is sourced from PubChem (CID 118855575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).