About CID 118855579
CID 118855579 (PubChem CID 118855579) has the molecular formula C55H54BCuN6S
and a molecular weight of 905.50 g/mol.
Molecular Properties
| Compound Name | CID 118855579 |
| PubChem CID | 118855579 |
| Molecular Formula | C55H54BCuN6S |
| Molecular Weight | 905.50 g/mol |
| Exact Mass | 904.35 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2ccn([B-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.[Cu+2].[S-]C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39BN6.C19H16S.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h10-21H,1-9H3;1-15,20H;/q-1;;+2/p-1 |
| InChIKey | NVNJFNPLPLDCIV-UHFFFAOYSA-M |
| XLogP | 12.51 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 905.50 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 118855579 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118855579?
The IUPAC name of CID 118855579 (CID 118855579) is not available.
What is the SMILES notation for CID 118855579?
The canonical SMILES for CID 118855579 is Cc1cc(C)c(-c2ccn([B-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.[Cu+2].[S-]C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 118855579?
The InChIKey is NVNJFNPLPLDCIV-UHFFFAOYSA-M. The full InChI is InChI=1S/C36H39BN6.C19H16S.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h10-21H,1-9H3;1-15,20H;/q-1;;+2/p-1.
What are the key properties of CID 118855579?
CID 118855579 has a molecular weight of 905.50 g/mol, XLogP of 12.51, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118855579 is sourced from PubChem (CID 118855579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).