About copper(1+);cyclopenta-1,3-diene;triethylphosphane
copper(1+);cyclopenta-1,3-diene;triethylphosphane (PubChem CID 118855782) has the molecular formula C11H20CuP
and a molecular weight of 246.80 g/mol. Its IUPAC name is copper(1+);cyclopenta-1,3-diene;triethylphosphane.
Molecular Properties
| Compound Name | copper(1+);cyclopenta-1,3-diene;triethylphosphane |
| PubChem CID | 118855782 |
| Molecular Formula | C11H20CuP |
| Molecular Weight | 246.80 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | copper(1+);cyclopenta-1,3-diene;triethylphosphane |
| SMILES | CCP(CC)CC.[Cu+].c1cc[cH-]c1 |
| InChI | InChI=1S/C6H15P.C5H5.Cu/c1-4-7(5-2)6-3;1-2-4-5-3-1;/h4-6H2,1-3H3;1-5H;/q;-1;+1 |
| InChIKey | HFLGHHCQULGGMX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);cyclopenta-1,3-diene;triethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);cyclopenta-1,3-diene;triethylphosphane?
The IUPAC name of copper(1+);cyclopenta-1,3-diene;triethylphosphane (CID 118855782) is copper(1+);cyclopenta-1,3-diene;triethylphosphane.
What is the SMILES notation for copper(1+);cyclopenta-1,3-diene;triethylphosphane?
The canonical SMILES for copper(1+);cyclopenta-1,3-diene;triethylphosphane is CCP(CC)CC.[Cu+].c1cc[cH-]c1.
What is the InChIKey of copper(1+);cyclopenta-1,3-diene;triethylphosphane?
The InChIKey is HFLGHHCQULGGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P.C5H5.Cu/c1-4-7(5-2)6-3;1-2-4-5-3-1;/h4-6H2,1-3H3;1-5H;/q;-1;+1.
What are the key properties of copper(1+);cyclopenta-1,3-diene;triethylphosphane?
copper(1+);cyclopenta-1,3-diene;triethylphosphane has a molecular weight of 246.80 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);cyclopenta-1,3-diene;triethylphosphane is sourced from PubChem (CID 118855782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).