C38H52Cl2N2O4 — CID 118855822
bis[(1R,5S)-8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 4-phenyl-2,3-dihydro-1H-naphthalene-1,4-dicarboxylate dichloride (PubChem CID 118855822) has the molecular formula C38H52Cl2N2O4 and a molecular weight of 671.75 g/mol. Its IUPAC name is bis[(1R,5S)-8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 4-phenyl-2,3-dihydro-1H-naphthalene-1,4-dicarboxylate dichloride.
| Compound Name | bis[(1R,5S)-8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 4-phenyl-2,3-dihydro-1H-naphthalene-1,4-dicarboxylate dichloride |
|---|---|
| PubChem CID | 118855822 |
| Molecular Formula | C38H52Cl2N2O4 |
| Molecular Weight | 671.75 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | bis[(1R,5S)-8-ethyl-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 4-phenyl-2,3-dihydro-1H-naphthalene-1,4-dicarboxylate dichloride |
| SMILES | CC[N+]1(C)[C@@H]2CC[C@H]1CC(OC(=O)C1CCC(C(=O)OC3C[C@H]4CC[C@@H](C3)[N+]4(C)CC)(c3ccccc3)c3ccccc31)C2.[Cl-].[Cl-] |
| InChI | InChI=1S/C38H52N2O4.2ClH/c1-5-39(3)27-16-17-28(39)23-31(22-27)43-36(41)34-20-21-38(26-12-8-7-9-13-26,35-15-11-10-14-33(34)35)37(42)44-32-24-29-18-19-30(25-32)40(29,4)6-2;;/h7-15,27-32,34H,5-6,16-25H2,1-4H3;2*1H/q+2;;/p-2/t27-,28+,29-,30+,31?,32?,34?,38?,39?,40?;; |
| InChIKey | HPWIBMJBDHQVMC-DQKPYGHYSA-L |
| XLogP | 0.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.75 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|