About SETOSUSIN
SETOSUSIN (PubChem CID 118856066) has the molecular formula C29H38O8
and a molecular weight of 514.62 g/mol.
Molecular Properties
| Compound Name | SETOSUSIN |
| PubChem CID | 118856066 |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@@H]1CC(=O)OC(C)(C)[C@H]2CC[C@@]3(C)[C@@H](CC=C(C)[C@]34C[C@]3(OC(C)=C(C)C3=O)C(=O)O4)[C@@]21C |
| InChI | InChI=1S/C29H38O8/c1-15-9-10-20-26(7,29(15)14-28(24(33)37-29)23(32)16(2)17(3)35-28)12-11-19-25(5,6)36-22(31)13-21(27(19,20)8)34-18(4)30/h9,19-21H,10-14H2,1-8H3/t19-,20-,21-,26+,27-,28-,29-/m1/s1 |
| InChIKey | SAYCZGIAVNNJNU-AKNVYCFDSA-N |
| XLogP | 4.35 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze SETOSUSIN with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of SETOSUSIN?
The IUPAC name of SETOSUSIN (CID 118856066) is not available.
What is the SMILES notation for SETOSUSIN?
The canonical SMILES for SETOSUSIN is CC(=O)O[C@@H]1CC(=O)OC(C)(C)[C@H]2CC[C@@]3(C)[C@@H](CC=C(C)[C@]34C[C@]3(OC(C)=C(C)C3=O)C(=O)O4)[C@@]21C.
What is the InChIKey of SETOSUSIN?
The InChIKey is SAYCZGIAVNNJNU-AKNVYCFDSA-N. The full InChI is InChI=1S/C29H38O8/c1-15-9-10-20-26(7,29(15)14-28(24(33)37-29)23(32)16(2)17(3)35-28)12-11-19-25(5,6)36-22(31)13-21(27(19,20)8)34-18(4)30/h9,19-21H,10-14H2,1-8H3/t19-,20-,21-,26+,27-,28-,29-/m1/s1.
What are the key properties of SETOSUSIN?
SETOSUSIN has a molecular weight of 514.62 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for SETOSUSIN is sourced from PubChem (CID 118856066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).