C28H48O4 — CID 118856698
[3-(octanoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl octanoate (PubChem CID 118856698) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is [3-(octanoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl octanoate.
| Compound Name | [3-(octanoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl octanoate |
|---|---|
| PubChem CID | 118856698 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | [3-(octanoyloxymethyl)-4-tricyclo[5.2.1.02,6]decanyl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCC1CC2C3CCC(C3)C2C1COC(=O)CCCCCCC |
| InChI | InChI=1S/C28H48O4/c1-3-5-7-9-11-13-26(29)31-19-23-18-24-21-15-16-22(17-21)28(24)25(23)20-32-27(30)14-12-10-8-6-4-2/h21-25,28H,3-20H2,1-2H3 |
| InChIKey | MELBJVBLJIDWGZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|