About magnesium methyl carbonate
magnesium methyl carbonate (PubChem CID 118856751) has the molecular formula C4H6MgO6
and a molecular weight of 174.39 g/mol. Its IUPAC name is magnesium methyl carbonate.
Molecular Properties
| Compound Name | magnesium methyl carbonate |
| PubChem CID | 118856751 |
| Molecular Formula | C4H6MgO6 |
| Molecular Weight | 174.39 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | magnesium methyl carbonate |
| SMILES | COC(=O)[O-].COC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C2H4O3.Mg/c2*1-5-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | CHKVEDLTACTUAS-UHFFFAOYSA-L |
| XLogP | -2.43 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.39 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze magnesium methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium methyl carbonate?
The IUPAC name of magnesium methyl carbonate (CID 118856751) is magnesium methyl carbonate.
What is the SMILES notation for magnesium methyl carbonate?
The canonical SMILES for magnesium methyl carbonate is COC(=O)[O-].COC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium methyl carbonate?
The InChIKey is CHKVEDLTACTUAS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H4O3.Mg/c2*1-5-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2.
What are the key properties of magnesium methyl carbonate?
magnesium methyl carbonate has a molecular weight of 174.39 g/mol, XLogP of -2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium methyl carbonate is sourced from PubChem (CID 118856751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).