C26H28N2O5 — CID 11885676
4-[(3R,3aR,7E)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-oxobutanoic acid (PubChem CID 11885676) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-[(3R,3aR,7E)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(3R,3aR,7E)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11885676 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 4-[(3R,3aR,7E)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-4-oxobutanoic acid |
| SMILES | COc1ccc(/C=C2\CCC[C@H]3C2=NN(C(=O)CCC(=O)O)[C@H]3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-32-20-10-6-17(7-11-20)16-19-4-3-5-22-25(19)27-28(23(29)14-15-24(30)31)26(22)18-8-12-21(33-2)13-9-18/h6-13,16,22,26H,3-5,14-15H2,1-2H3,(H,30,31)/b19-16+/t22-,26-/m0/s1 |
| InChIKey | ZZVWZXKNRNMQJM-JBMBNRJBSA-N |
| XLogP | 4.69 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |