C46H38FN3O4 — CID 118857180
9-(4-fluorophenyl)-3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)carbazole-3,6-diamine (PubChem CID 118857180) has the molecular formula C46H38FN3O4 and a molecular weight of 715.83 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)carbazole-3,6-diamine.
| Compound Name | 9-(4-fluorophenyl)-3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)carbazole-3,6-diamine |
|---|---|
| PubChem CID | 118857180 |
| Molecular Formula | C46H38FN3O4 |
| Molecular Weight | 715.83 g/mol |
| Exact Mass | 715.28 |
| IUPAC Name | 9-(4-fluorophenyl)-3-N,3-N,6-N,6-N-tetrakis(4-methoxyphenyl)carbazole-3,6-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)c2cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ccc2n3-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C46H38FN3O4/c1-51-39-19-9-32(10-20-39)48(33-11-21-40(52-2)22-12-33)37-17-27-45-43(29-37)44-30-38(18-28-46(44)50(45)36-7-5-31(47)6-8-36)49(34-13-23-41(53-3)24-14-34)35-15-25-42(54-4)26-16-35/h5-30H,1-4H3 |
| InChIKey | YPUXHYSQFDEREV-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.83 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |