C31H41FN4 — CID 118857242
2,4-ditert-butyl-6-[6-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 118857242) has the molecular formula C31H41FN4 and a molecular weight of 488.70 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[6-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[6-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 118857242 |
| Molecular Formula | C31H41FN4 |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[6-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc(-c3cc(F)c4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C31H41FN4/c1-27(2,3)25-34-24(35-26(36-25)28(4,5)6)18-13-14-22(33-17-18)19-15-20-23(21(32)16-19)30(9,10)31(11,12)29(20,7)8/h13-17H,1-12H3 |
| InChIKey | PGOAZSZRSKVCJH-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |