C30H31F2N5 — CID 118857251
4-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-4-methyl-3-pyridinyl]-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 118857251) has the molecular formula C30H31F2N5 and a molecular weight of 499.61 g/mol. Its IUPAC name is 4-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-4-methyl-3-pyridinyl]-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-4-methyl-3-pyridinyl]-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118857251 |
| Molecular Formula | C30H31F2N5 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 4-[6-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-4-methyl-3-pyridinyl]-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | Cc1cc(-c2ccc3c(c2)C(C)(C)C(F)(F)C3(C)C)ncc1-c1nc(-c2ccccc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C30H31F2N5/c1-18-15-24(20-13-14-22-23(16-20)29(4,5)30(31,32)28(22,2)3)33-17-21(18)26-34-25(19-11-9-8-10-12-19)35-27(36-26)37(6)7/h8-17H,1-7H3 |
| InChIKey | JZGZUEIHUHJAJR-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |