C24H24BrF3N2 — CID 118857257
8-bromo-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 118857257) has the molecular formula C24H24BrF3N2 and a molecular weight of 477.37 g/mol. Its IUPAC name is 8-bromo-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 8-bromo-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 118857257 |
| Molecular Formula | C24H24BrF3N2 |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 8-bromo-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | CC1(C)c2ccc(-c3ncc(Br)c4nc(C(F)(F)F)ccc34)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C24H24BrF3N2/c1-21(2)15-9-7-13(11-16(15)22(3,4)23(21,5)6)19-14-8-10-18(24(26,27)28)30-20(14)17(25)12-29-19/h7-12H,1-6H3 |
| InChIKey | HIAFHHFYQUZOQC-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |