C32H35F2N5 — CID 118857266
4-[6-(6-ethyl-2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-4-methyl-3-pyridinyl]-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 118857266) has the molecular formula C32H35F2N5 and a molecular weight of 527.66 g/mol. Its IUPAC name is 4-[6-(6-ethyl-2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-4-methyl-3-pyridinyl]-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[6-(6-ethyl-2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-4-methyl-3-pyridinyl]-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118857266 |
| Molecular Formula | C32H35F2N5 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 4-[6-(6-ethyl-2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-4-methyl-3-pyridinyl]-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | CCc1cc2c(cc1-c1cc(C)c(-c3nc(-c4ccccc4)nc(N(C)C)n3)cn1)C(C)(C)C(F)(F)C2(C)C |
| InChI | InChI=1S/C32H35F2N5/c1-9-20-16-24-25(31(5,6)32(33,34)30(24,3)4)17-22(20)26-15-19(2)23(18-35-26)28-36-27(21-13-11-10-12-14-21)37-29(38-28)39(7)8/h10-18H,9H2,1-8H3 |
| InChIKey | HPSSISLXZATIEQ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |